C16H24ClNO — CID 106354683
N-(1-chloro-4-methylpentan-3-yl)-2-(2,5-dimethylphenyl)acetamide (PubChem CID 106354683) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-2-(2,5-dimethylphenyl)acetamide.
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-2-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 106354683 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-2-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(CC(=O)NC(CCCl)C(C)C)c1 |
| InChI | InChI=1S/C16H24ClNO/c1-11(2)15(7-8-17)18-16(19)10-14-9-12(3)5-6-13(14)4/h5-6,9,11,15H,7-8,10H2,1-4H3,(H,18,19) |
| InChIKey | VPUSINFYXRBRMF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|