C11H15N3O3 — CID 62541095
2-hydroxy-6-oxo-N-(pyrrolidin-2-ylmethyl)-1H-pyridine-4-carboxamide (PubChem CID 62541095) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-N-(pyrrolidin-2-ylmethyl)-1H-pyridine-4-carboxamide.
| Compound Name | 2-hydroxy-6-oxo-N-(pyrrolidin-2-ylmethyl)-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62541095 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-hydroxy-6-oxo-N-(pyrrolidin-2-ylmethyl)-1H-pyridine-4-carboxamide |
| SMILES | O=C(NCC1CCCN1)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C11H15N3O3/c15-9-4-7(5-10(16)14-9)11(17)13-6-8-2-1-3-12-8/h4-5,8,12H,1-3,6H2,(H,13,17)(H2,14,15,16) |
| InChIKey | BNGGOBMADQQMOG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |