C13H15Cl3N2O2 — CID 62544265
1-piperazin-1-yl-3-(2,4,6-trichlorophenoxy)propan-1-one (PubChem CID 62544265) has the molecular formula C13H15Cl3N2O2 and a molecular weight of 337.63 g/mol. Its IUPAC name is 1-piperazin-1-yl-3-(2,4,6-trichlorophenoxy)propan-1-one.
| Compound Name | 1-piperazin-1-yl-3-(2,4,6-trichlorophenoxy)propan-1-one |
|---|---|
| PubChem CID | 62544265 |
| Molecular Formula | C13H15Cl3N2O2 |
| Molecular Weight | 337.63 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 1-piperazin-1-yl-3-(2,4,6-trichlorophenoxy)propan-1-one |
| SMILES | O=C(CCOc1c(Cl)cc(Cl)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H15Cl3N2O2/c14-9-7-10(15)13(11(16)8-9)20-6-1-12(19)18-4-2-17-3-5-18/h7-8,17H,1-6H2 |
| InChIKey | FTBKLOSXVOBDSG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |