C15H18Cl2N2OS — CID 62544919
N-[(3,4-dichlorophenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methoxyethanamine (PubChem CID 62544919) has the molecular formula C15H18Cl2N2OS and a molecular weight of 345.30 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(3,4-dichlorophenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 62544919 |
| Molecular Formula | C15H18Cl2N2OS |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-[(3,4-dichlorophenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNC(c1ccc(Cl)c(Cl)c1)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C15H18Cl2N2OS/c1-9-10(2)21-15(19-9)14(18-6-7-20-3)11-4-5-12(16)13(17)8-11/h4-5,8,14,18H,6-7H2,1-3H3 |
| InChIKey | VRPMJILFQRJADR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|