C25H22N2O5 — CID 6254782
[4-[(Z)-(benzoylhydrazinylidene)methyl]phenyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 6254782) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is [4-[(Z)-(benzoylhydrazinylidene)methyl]phenyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(Z)-(benzoylhydrazinylidene)methyl]phenyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6254782 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [4-[(Z)-(benzoylhydrazinylidene)methyl]phenyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc(/C=N\NC(=O)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C25H22N2O5/c1-30-22-14-10-18(16-23(22)31-2)11-15-24(28)32-21-12-8-19(9-13-21)17-26-27-25(29)20-6-4-3-5-7-20/h3-17H,1-2H3,(H,27,29)/b15-11+,26-17- |
| InChIKey | MCONAJWAQHMYIA-QIQMYUKISA-N |
| XLogP | 4.09 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|