C17H18ClNO2 — CID 62548299
(2,4,6-trimethylphenyl)methyl 5-amino-2-chlorobenzoate (PubChem CID 62548299) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)methyl 5-amino-2-chlorobenzoate.
| Compound Name | (2,4,6-trimethylphenyl)methyl 5-amino-2-chlorobenzoate |
|---|---|
| PubChem CID | 62548299 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2,4,6-trimethylphenyl)methyl 5-amino-2-chlorobenzoate |
| SMILES | Cc1cc(C)c(COC(=O)c2cc(N)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H18ClNO2/c1-10-6-11(2)15(12(3)7-10)9-21-17(20)14-8-13(19)4-5-16(14)18/h4-8H,9,19H2,1-3H3 |
| InChIKey | ZFAKTRRNBYTCOC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|