C25H19ClN2O3S — CID 6254916
(2Z)-2-[[4-[2-(4-chloro-2-methylphenoxy)ethoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 6254916) has the molecular formula C25H19ClN2O3S and a molecular weight of 462.96 g/mol. Its IUPAC name is (2Z)-2-[[4-[2-(4-chloro-2-methylphenoxy)ethoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2Z)-2-[[4-[2-(4-chloro-2-methylphenoxy)ethoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 6254916 |
| Molecular Formula | C25H19ClN2O3S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (2Z)-2-[[4-[2-(4-chloro-2-methylphenoxy)ethoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | Cc1cc(Cl)ccc1OCCOc1ccc(/C=c2\sc3nc4ccccc4n3c2=O)cc1 |
| InChI | InChI=1S/C25H19ClN2O3S/c1-16-14-18(26)8-11-22(16)31-13-12-30-19-9-6-17(7-10-19)15-23-24(29)28-21-5-3-2-4-20(21)27-25(28)32-23/h2-11,14-15H,12-13H2,1H3/b23-15- |
| InChIKey | GORNCCKICJSNNG-HAHDFKILSA-N |
| XLogP | 4.88 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|