C12H18BrN3O — CID 62551986
[1-[(3-amino-5-bromo-2-pyridinyl)amino]cyclohexyl]methanol (PubChem CID 62551986) has the molecular formula C12H18BrN3O and a molecular weight of 300.20 g/mol. Its IUPAC name is [1-[(3-amino-5-bromo-2-pyridinyl)amino]cyclohexyl]methanol.
| Compound Name | [1-[(3-amino-5-bromo-2-pyridinyl)amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 62551986 |
| Molecular Formula | C12H18BrN3O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | [1-[(3-amino-5-bromo-2-pyridinyl)amino]cyclohexyl]methanol |
| SMILES | Nc1cc(Br)cnc1NC1(CO)CCCCC1 |
| InChI | InChI=1S/C12H18BrN3O/c13-9-6-10(14)11(15-7-9)16-12(8-17)4-2-1-3-5-12/h6-7,17H,1-5,8,14H2,(H,15,16) |
| InChIKey | YCRMWPPJILSNCU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |