C12H19BrN4O — CID 114072202
[1-[[5-bromo-6-(methylamino)pyrimidin-4-yl]amino]cyclohexyl]methanol (PubChem CID 114072202) has the molecular formula C12H19BrN4O and a molecular weight of 315.22 g/mol. Its IUPAC name is [1-[[5-bromo-6-(methylamino)pyrimidin-4-yl]amino]cyclohexyl]methanol.
| Compound Name | [1-[[5-bromo-6-(methylamino)pyrimidin-4-yl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 114072202 |
| Molecular Formula | C12H19BrN4O |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [1-[[5-bromo-6-(methylamino)pyrimidin-4-yl]amino]cyclohexyl]methanol |
| SMILES | CNc1ncnc(NC2(CO)CCCCC2)c1Br |
| InChI | InChI=1S/C12H19BrN4O/c1-14-10-9(13)11(16-8-15-10)17-12(7-18)5-3-2-4-6-12/h8,18H,2-7H2,1H3,(H2,14,15,16,17) |
| InChIKey | HDPFPJFWIBFWRT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |