C28H37N3O8 — CID 6255262
(E)-[1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methanolate (PubChem CID 6255262) has the molecular formula C28H37N3O8 and a molecular weight of 543.62 g/mol. Its IUPAC name is (E)-[1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methanolate.
| Compound Name | (E)-[1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methanolate |
|---|---|
| PubChem CID | 6255262 |
| Molecular Formula | C28H37N3O8 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (E)-[1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methanolate |
| SMILES | CCOC(=O)c1[nH]c(C)c(/C([O-])=C2\C(=O)C(=O)N(CCC[NH+](C)C)C2c2cc(OC)c(OC)c(OC)c2)c1C |
| InChI | InChI=1S/C28H37N3O8/c1-9-39-28(35)22-15(2)20(16(3)29-22)24(32)21-23(31(27(34)25(21)33)12-10-11-30(4)5)17-13-18(36-6)26(38-8)19(14-17)37-7/h13-14,23,29,32H,9-12H2,1-8H3/b24-21+ |
| InChIKey | SDFLFVSHVQQACN-DARPEHSRSA-N |
| XLogP | 0.59 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|