C28H35N3O9 — CID 4288539
(5-methoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-[1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]methanolate (PubChem CID 4288539) has the molecular formula C28H35N3O9 and a molecular weight of 557.60 g/mol. Its IUPAC name is (5-methoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-[1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]methanolate.
| Compound Name | (5-methoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-[1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 4288539 |
| Molecular Formula | C28H35N3O9 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (5-methoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-[1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]methanolate |
| SMILES | COC(=O)c1[nH]c(C)c(C([O-])=C2C(=O)C(=O)N(CC[NH+]3CCOCC3)C2c2cc(OC)c(OC)c(OC)c2)c1C |
| InChI | InChI=1S/C28H35N3O9/c1-15-20(16(2)29-22(15)28(35)39-6)24(32)21-23(17-13-18(36-3)26(38-5)19(14-17)37-4)31(27(34)25(21)33)8-7-30-9-11-40-12-10-30/h13-14,23,29,32H,7-12H2,1-6H3 |
| InChIKey | WDUDWKVBKQFLKE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|