C29H35N2O8+ — CID 9497959
(5R)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(2-morpholin-4-ium-4-ylethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 9497959) has the molecular formula C29H35N2O8+ and a molecular weight of 539.61 g/mol. Its IUPAC name is (5R)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(2-morpholin-4-ium-4-ylethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(2-morpholin-4-ium-4-ylethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 9497959 |
| Molecular Formula | C29H35N2O8+ |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (5R)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(2-morpholin-4-ium-4-ylethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@@H]2C(=C(O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2CC[NH+]2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C29H34N2O8/c1-17-13-19-14-18(5-6-21(19)39-17)26(32)24-25(20-15-22(35-2)28(37-4)23(16-20)36-3)31(29(34)27(24)33)8-7-30-9-11-38-12-10-30/h5-6,14-17,25,32H,7-13H2,1-4H3/p+1/t17-,25+/m0/s1 |
| InChIKey | CJFDEOMSEUMLKX-SSOJOUAXSA-O |
| XLogP | 1.37 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|