C33H35N2O6+ — CID 9497998
(5S)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 9497998) has the molecular formula C33H35N2O6+ and a molecular weight of 555.65 g/mol. Its IUPAC name is (5S)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 9497998 |
| Molecular Formula | C33H35N2O6+ |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | (5S)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C[C@@H]1Cc2cc(C(O)=C3C(=O)C(=O)N(CCC[NH+]4CCOCC4)[C@H]3c3cccc(Oc4ccccc4)c3)ccc2O1 |
| InChI | InChI=1S/C33H34N2O6/c1-22-19-25-20-24(11-12-28(25)40-22)31(36)29-30(23-7-5-10-27(21-23)41-26-8-3-2-4-9-26)35(33(38)32(29)37)14-6-13-34-15-17-39-18-16-34/h2-5,7-12,20-22,30,36H,6,13-19H2,1H3/p+1/t22-,30+/m1/s1 |
| InChIKey | OUTNSWVZHARXNQ-RCRUUEGKSA-O |
| XLogP | 3.53 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|