C13H28F3N3 — CID 62554657
N',N'-diethyl-N-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]ethyl]ethane-1,2-diamine (PubChem CID 62554657) has the molecular formula C13H28F3N3 and a molecular weight of 283.38 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62554657 |
| Molecular Formula | C13H28F3N3 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.22 |
| IUPAC Name | N',N'-diethyl-N-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]ethyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H28F3N3/c1-5-18(6-2)9-7-17-8-10-19(12(3)4)11-13(14,15)16/h12,17H,5-11H2,1-4H3 |
| InChIKey | UGCQZUIWHAGBQV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|