C10H19F3N2O2S — CID 62554664
N'-cyclopropyl-N-(2-methylsulfonylethyl)-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62554664) has the molecular formula C10H19F3N2O2S and a molecular weight of 288.34 g/mol. Its IUPAC name is N'-cyclopropyl-N-(2-methylsulfonylethyl)-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N-(2-methylsulfonylethyl)-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62554664 |
| Molecular Formula | C10H19F3N2O2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N'-cyclopropyl-N-(2-methylsulfonylethyl)-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CS(=O)(=O)CCNCCN(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H19F3N2O2S/c1-18(16,17)7-5-14-4-6-15(9-2-3-9)8-10(11,12)13/h9,14H,2-8H2,1H3 |
| InChIKey | JVTSJVLZEUOVJJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|