C12H18N2O — CID 62559098
N'-methyl-N'-[(5-methylfuran-2-yl)methyl]-N-prop-2-ynylethane-1,2-diamine (PubChem CID 62559098) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N'-methyl-N'-[(5-methylfuran-2-yl)methyl]-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | N'-methyl-N'-[(5-methylfuran-2-yl)methyl]-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 62559098 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N'-methyl-N'-[(5-methylfuran-2-yl)methyl]-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNCCN(C)Cc1ccc(C)o1 |
| InChI | InChI=1S/C12H18N2O/c1-4-7-13-8-9-14(3)10-12-6-5-11(2)15-12/h1,5-6,13H,7-10H2,2-3H3 |
| InChIKey | MPAJQMYBBYJXRY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|