C14H23BrN2 — CID 62561481
N-(2-bromophenyl)-N'-butan-2-yl-N'-ethylethane-1,2-diamine (PubChem CID 62561481) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-butan-2-yl-N'-ethylethane-1,2-diamine.
| Compound Name | N-(2-bromophenyl)-N'-butan-2-yl-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 62561481 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(2-bromophenyl)-N'-butan-2-yl-N'-ethylethane-1,2-diamine |
| SMILES | CCC(C)N(CC)CCNc1ccccc1Br |
| InChI | InChI=1S/C14H23BrN2/c1-4-12(3)17(5-2)11-10-16-14-9-7-6-8-13(14)15/h6-9,12,16H,4-5,10-11H2,1-3H3 |
| InChIKey | RKVKJHANHPGQJW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |