C16H27FN2 — CID 63502082
N'-butan-2-yl-N'-butyl-N-(2-fluorophenyl)ethane-1,2-diamine (PubChem CID 63502082) has the molecular formula C16H27FN2 and a molecular weight of 266.40 g/mol. Its IUPAC name is N'-butan-2-yl-N'-butyl-N-(2-fluorophenyl)ethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N'-butyl-N-(2-fluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63502082 |
| Molecular Formula | C16H27FN2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | N'-butan-2-yl-N'-butyl-N-(2-fluorophenyl)ethane-1,2-diamine |
| SMILES | CCCCN(CCNc1ccccc1F)C(C)CC |
| InChI | InChI=1S/C16H27FN2/c1-4-6-12-19(14(3)5-2)13-11-18-16-10-8-7-9-15(16)17/h7-10,14,18H,4-6,11-13H2,1-3H3 |
| InChIKey | NCRGPJHHIKTTMD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |