C16H23N3O — CID 62562143
3-[2-(3,3-dimethylbutylamino)ethyl]quinazolin-4-one (PubChem CID 62562143) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[2-(3,3-dimethylbutylamino)ethyl]quinazolin-4-one.
| Compound Name | 3-[2-(3,3-dimethylbutylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 62562143 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-[2-(3,3-dimethylbutylamino)ethyl]quinazolin-4-one |
| SMILES | CC(C)(C)CCNCCn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C16H23N3O/c1-16(2,3)8-9-17-10-11-19-12-18-14-7-5-4-6-13(14)15(19)20/h4-7,12,17H,8-11H2,1-3H3 |
| InChIKey | DQEPJTUUSVHSNS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|