C10H14F3N3O — CID 62563288
4,6-dimethyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyrimidin-2-one (PubChem CID 62563288) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 4,6-dimethyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyrimidin-2-one.
| Compound Name | 4,6-dimethyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 62563288 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4,6-dimethyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyrimidin-2-one |
| SMILES | Cc1cc(C)n(CCNCC(F)(F)F)c(=O)n1 |
| InChI | InChI=1S/C10H14F3N3O/c1-7-5-8(2)16(9(17)15-7)4-3-14-6-10(11,12)13/h5,14H,3-4,6H2,1-2H3 |
| InChIKey | XJXKUTCFFSCRBN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|