C8H13N3OS — CID 123478764
4,6-dimethyl-1-[2-(sulfanylamino)ethyl]pyrimidin-2-one (PubChem CID 123478764) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 4,6-dimethyl-1-[2-(sulfanylamino)ethyl]pyrimidin-2-one.
| Compound Name | 4,6-dimethyl-1-[2-(sulfanylamino)ethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 123478764 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4,6-dimethyl-1-[2-(sulfanylamino)ethyl]pyrimidin-2-one |
| SMILES | Cc1cc(C)n(CCNS)c(=O)n1 |
| InChI | InChI=1S/C8H13N3OS/c1-6-5-7(2)11(4-3-9-13)8(12)10-6/h5,9,13H,3-4H2,1-2H3 |
| InChIKey | SQHQSAMKJIWCKD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|