C8H14N3O+ — CID 7200828
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylazanium (PubChem CID 7200828) has the molecular formula C8H14N3O+ and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylazanium.
| Compound Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylazanium |
|---|---|
| PubChem CID | 7200828 |
| Molecular Formula | C8H14N3O+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylazanium |
| SMILES | Cc1cc(C)n(CC[NH3+])c(=O)n1 |
| InChI | InChI=1S/C8H13N3O/c1-6-5-7(2)11(4-3-9)8(12)10-6/h5H,3-4,9H2,1-2H3/p+1 |
| InChIKey | IDKKEJGBRLXUHN-UHFFFAOYSA-O |
| XLogP | -0.90 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |