C14H19N5O — CID 62563641
N-(oxolan-2-ylmethyl)-2-(5-phenyltetrazol-2-yl)ethanamine (PubChem CID 62563641) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-(5-phenyltetrazol-2-yl)ethanamine.
| Compound Name | N-(oxolan-2-ylmethyl)-2-(5-phenyltetrazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 62563641 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-(5-phenyltetrazol-2-yl)ethanamine |
| SMILES | c1ccc(-c2nnn(CCNCC3CCCO3)n2)cc1 |
| InChI | InChI=1S/C14H19N5O/c1-2-5-12(6-3-1)14-16-18-19(17-14)9-8-15-11-13-7-4-10-20-13/h1-3,5-6,13,15H,4,7-11H2 |
| InChIKey | RJOAYTYKBWTTMS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|