C16H26FN3O — CID 62573942
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-methoxypropan-2-amine (PubChem CID 62573942) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-methoxypropan-2-amine.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 62573942 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-methoxypropan-2-amine |
| SMILES | COCC(C)NCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H26FN3O/c1-14(13-21-2)18-7-8-19-9-11-20(12-10-19)16-5-3-15(17)4-6-16/h3-6,14,18H,7-13H2,1-2H3 |
| InChIKey | PTCIWOINUOVKJT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |