C12H17N3S2 — CID 62582122
2-(1-methylpyrazol-4-yl)sulfanyl-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 62582122) has the molecular formula C12H17N3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)sulfanyl-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | 2-(1-methylpyrazol-4-yl)sulfanyl-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 62582122 |
| Molecular Formula | C12H17N3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)sulfanyl-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | CC(CNCc1cccs1)Sc1cnn(C)c1 |
| InChI | InChI=1S/C12H17N3S2/c1-10(17-12-8-14-15(2)9-12)6-13-7-11-4-3-5-16-11/h3-5,8-10,13H,6-7H2,1-2H3 |
| InChIKey | BGAKVXGSRVUQEU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |