C13H23NO2S — CID 62584051
N-(3-ethoxypropyl)-2-(thiophen-2-ylmethoxy)propan-1-amine (PubChem CID 62584051) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-(thiophen-2-ylmethoxy)propan-1-amine.
| Compound Name | N-(3-ethoxypropyl)-2-(thiophen-2-ylmethoxy)propan-1-amine |
|---|---|
| PubChem CID | 62584051 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(3-ethoxypropyl)-2-(thiophen-2-ylmethoxy)propan-1-amine |
| SMILES | CCOCCCNCC(C)OCc1cccs1 |
| InChI | InChI=1S/C13H23NO2S/c1-3-15-8-5-7-14-10-12(2)16-11-13-6-4-9-17-13/h4,6,9,12,14H,3,5,7-8,10-11H2,1-2H3 |
| InChIKey | URLQDQHRXVUDTL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|