C15H23N3O2S — CID 62585236
4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(2-methoxyethyl)butan-1-amine (PubChem CID 62585236) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(2-methoxyethyl)butan-1-amine.
| Compound Name | 4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(2-methoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 62585236 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(2-methoxyethyl)butan-1-amine |
| SMILES | COCCNCCCCSc1nc2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C15H23N3O2S/c1-19-9-8-16-7-3-4-10-21-15-17-13-6-5-12(20-2)11-14(13)18-15/h5-6,11,16H,3-4,7-10H2,1-2H3,(H,17,18) |
| InChIKey | IQRFEAJYFSEVLZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|