C13H11ClN4O2 — CID 625871
8-chloro-3,7,10-trimethylbenzo[g]pteridine-2,4-dione (PubChem CID 625871) has the molecular formula C13H11ClN4O2 and a molecular weight of 290.71 g/mol. Its IUPAC name is 8-chloro-3,7,10-trimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 8-chloro-3,7,10-trimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 625871 |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 8-chloro-3,7,10-trimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)n(C)c(=O)nc-3n(C)c2cc1Cl |
| InChI | InChI=1S/C13H11ClN4O2/c1-6-4-8-9(5-7(6)14)17(2)11-10(15-8)12(19)18(3)13(20)16-11/h4-5H,1-3H3 |
| InChIKey | IWRRDKABNZUMPJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|