C19H23ClN4O3 — CID 166558328
7-chloro-10-[2-(2,2-dimethylpropoxy)ethyl]-8-ethylbenzo[g]pteridine-2,4-dione (PubChem CID 166558328) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 7-chloro-10-[2-(2,2-dimethylpropoxy)ethyl]-8-ethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 7-chloro-10-[2-(2,2-dimethylpropoxy)ethyl]-8-ethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 166558328 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 7-chloro-10-[2-(2,2-dimethylpropoxy)ethyl]-8-ethylbenzo[g]pteridine-2,4-dione |
| SMILES | CCc1cc2c(cc1Cl)nc1c(=O)[nH]c(=O)nc-1n2CCOCC(C)(C)C |
| InChI | InChI=1S/C19H23ClN4O3/c1-5-11-8-14-13(9-12(11)20)21-15-16(22-18(26)23-17(15)25)24(14)6-7-27-10-19(2,3)4/h8-9H,5-7,10H2,1-4H3,(H,23,25,26) |
| InChIKey | MHJCGZKBLYTIMI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|