C12H9ClN4O2 — CID 102212998
7-chloro-8,10-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 102212998) has the molecular formula C12H9ClN4O2 and a molecular weight of 276.68 g/mol. Its IUPAC name is 7-chloro-8,10-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 7-chloro-8,10-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 102212998 |
| Molecular Formula | C12H9ClN4O2 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 7-chloro-8,10-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2c(cc1Cl)nc1c(=O)[nH]c(=O)nc-1n2C |
| InChI | InChI=1S/C12H9ClN4O2/c1-5-3-8-7(4-6(5)13)14-9-10(17(8)2)15-12(19)16-11(9)18/h3-4H,1-2H3,(H,16,18,19) |
| InChIKey | UQISXUBQTJWPDV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|