7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride

C13H9ClN4O3 — CID 20674189

IUPAC7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride
SMILESCc1cc2nc3c(=O)[nH]c(=O)nc-3n(C)c2cc1C(=O)Cl
InChIInChI=1S/C13H9ClN4O3/c1-5-3-7-8(4-6(5)10(14)19)18(2)11-9(15-7)12(20)17-13(21)16-11/h3-4H,1-2H3,(H,17,20,21)
InChIKeyWFTFWZXMGPVSTN-UHFFFAOYSA-N
MW304.69 g/mol
LogP0.81
Rot. Bonds1

About 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride

7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride (PubChem CID 20674189) has the molecular formula C13H9ClN4O3 and a molecular weight of 304.69 g/mol. Its IUPAC name is 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride.

Molecular Properties

Compound Name7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride
PubChem CID20674189
Molecular FormulaC13H9ClN4O3
Molecular Weight304.69 g/mol
Exact Mass304.04
IUPAC Name7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride
SMILESCc1cc2nc3c(=O)[nH]c(=O)nc-3n(C)c2cc1C(=O)Cl
InChIInChI=1S/C13H9ClN4O3/c1-5-3-7-8(4-6(5)10(14)19)18(2)11-9(15-7)12(20)17-13(21)16-11/h3-4H,1-2H3,(H,17,20,21)
InChIKeyWFTFWZXMGPVSTN-UHFFFAOYSA-N
XLogP0.81
TPSA97.71 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.69
LogP ≤ 50.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride?
The IUPAC name of 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride (CID 20674189) is 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride.
What is the SMILES notation for 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride?
The canonical SMILES for 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride is Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C)c2cc1C(=O)Cl.
What is the InChIKey of 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride?
The InChIKey is WFTFWZXMGPVSTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN4O3/c1-5-3-7-8(4-6(5)10(14)19)18(2)11-9(15-7)12(20)17-13(21)16-11/h3-4H,1-2H3,(H,17,20,21).
What are the key properties of 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride?
7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride has a molecular weight of 304.69 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride is sourced from PubChem (CID 20674189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).