C13H9ClN4O3 — CID 20674189
7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride (PubChem CID 20674189) has the molecular formula C13H9ClN4O3 and a molecular weight of 304.69 g/mol. Its IUPAC name is 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride.
| Compound Name | 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride |
|---|---|
| PubChem CID | 20674189 |
| Molecular Formula | C13H9ClN4O3 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 7,10-dimethyl-2,4-dioxobenzo[g]pteridine-8-carbonyl chloride |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C)c2cc1C(=O)Cl |
| InChI | InChI=1S/C13H9ClN4O3/c1-5-3-7-8(4-6(5)10(14)19)18(2)11-9(15-7)12(20)17-13(21)16-11/h3-4H,1-2H3,(H,17,20,21) |
| InChIKey | WFTFWZXMGPVSTN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|