C17H22N4O6 — CID 161044136
10-[3-hydroxy-2-(hydroxymethyl)propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione;methanediol (PubChem CID 161044136) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is 10-[3-hydroxy-2-(hydroxymethyl)propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione;methanediol.
| Compound Name | 10-[3-hydroxy-2-(hydroxymethyl)propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione;methanediol |
|---|---|
| PubChem CID | 161044136 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 10-[3-hydroxy-2-(hydroxymethyl)propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione;methanediol |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(CO)CO)c2cc1C.OCO |
| InChI | InChI=1S/C16H18N4O4.CH4O2/c1-8-3-11-12(4-9(8)2)20(5-10(6-21)7-22)14-13(17-11)15(23)19-16(24)18-14;2-1-3/h3-4,10,21-22H,5-7H2,1-2H3,(H,19,23,24);2-3H,1H2 |
| InChIKey | UBGRKIPEDLQBJD-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 161.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|