C17H19N4Na2O9P — CID 87061455
disodium;[(2R,3S,4S)-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-3,4,5-trihydroxypentan-2-yl] phosphate (PubChem CID 87061455) has the molecular formula C17H19N4Na2O9P and a molecular weight of 500.31 g/mol. Its IUPAC name is disodium;[(2R,3S,4S)-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-3,4,5-trihydroxypentan-2-yl] phosphate.
| Compound Name | disodium;[(2R,3S,4S)-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-3,4,5-trihydroxypentan-2-yl] phosphate |
|---|---|
| PubChem CID | 87061455 |
| Molecular Formula | C17H19N4Na2O9P |
| Molecular Weight | 500.31 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | disodium;[(2R,3S,4S)-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-3,4,5-trihydroxypentan-2-yl] phosphate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@@H](OP(=O)([O-])[O-])[C@@H](O)[C@@H](O)CO)c2cc1C.[Na+].[Na+] |
| InChI | InChI=1S/C17H21N4O9P.2Na/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-12(30-31(27,28)29)14(24)11(23)6-22;;/h3-4,11-12,14,22-24H,5-6H2,1-2H3,(H,20,25,26)(H2,27,28,29);;/q;2*+1/p-2/t11-,12+,14-;;/m0../s1 |
| InChIKey | BEZDTXONABQNED-APQIITSESA-L |
| XLogP | -8.86 |
| TPSA | 213.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.31 |
| LogP ≤ 5 | -8.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|