C22H25N5NaO10P — CID 122690119
sodium;[(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] hydrogen phosphate;1H-pyridin-4-one (PubChem CID 122690119) has the molecular formula C22H25N5NaO10P and a molecular weight of 573.43 g/mol. Its IUPAC name is sodium;[(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] hydrogen phosphate;1H-pyridin-4-one.
| Compound Name | sodium;[(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] hydrogen phosphate;1H-pyridin-4-one |
|---|---|
| PubChem CID | 122690119 |
| Molecular Formula | C22H25N5NaO10P |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | sodium;[(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] hydrogen phosphate;1H-pyridin-4-one |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)COP(=O)([O-])O)c2cc1C.O=c1cc[nH]cc1.[Na+] |
| InChI | InChI=1S/C17H21N4O9P.C5H5NO.Na/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-11(22)14(24)12(23)6-30-31(27,28)29;7-5-1-3-6-4-2-5;/h3-4,11-12,14,22-24H,5-6H2,1-2H3,(H,20,25,26)(H2,27,28,29);1-4H,(H,6,7);/q;;+1/p-1/t11-,12+,14-;;/m0../s1 |
| InChIKey | OBLOBCSUVCYKHL-APQIITSESA-M |
| XLogP | -4.86 |
| TPSA | 243.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|