C18H24N5O9P — CID 87168511
[5-[8-(dimethylamino)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]-2,3,4-trihydroxypentyl] dihydrogen phosphate (PubChem CID 87168511) has the molecular formula C18H24N5O9P and a molecular weight of 485.39 g/mol. Its IUPAC name is [5-[8-(dimethylamino)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]-2,3,4-trihydroxypentyl] dihydrogen phosphate.
| Compound Name | [5-[8-(dimethylamino)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]-2,3,4-trihydroxypentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87168511 |
| Molecular Formula | C18H24N5O9P |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | [5-[8-(dimethylamino)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]-2,3,4-trihydroxypentyl] dihydrogen phosphate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(O)COP(=O)(O)O)c2cc1N(C)C |
| InChI | InChI=1S/C18H24N5O9P/c1-8-4-9-11(5-10(8)22(2)3)23(16-14(19-9)17(27)21-18(28)20-16)6-12(24)15(26)13(25)7-32-33(29,30)31/h4-5,12-13,15,24-26H,6-7H2,1-3H3,(H,21,27,28)(H2,29,30,31) |
| InChIKey | LHWABZZSVDZYSV-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 211.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|