C17H20N4O5 — CID 166944134
7,8-dimethyl-10-[(2R)-2,4,5-trihydroxypentyl]benzo[g]pteridine-2,4-dione (PubChem CID 166944134) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 7,8-dimethyl-10-[(2R)-2,4,5-trihydroxypentyl]benzo[g]pteridine-2,4-dione.
| Compound Name | 7,8-dimethyl-10-[(2R)-2,4,5-trihydroxypentyl]benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 166944134 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 7,8-dimethyl-10-[(2R)-2,4,5-trihydroxypentyl]benzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@H](O)CC(O)CO)c2cc1C |
| InChI | InChI=1S/C17H20N4O5/c1-8-3-12-13(4-9(8)2)21(6-10(23)5-11(24)7-22)15-14(18-12)16(25)20-17(26)19-15/h3-4,10-11,22-24H,5-7H2,1-2H3,(H,20,25,26)/t10-,11?/m1/s1 |
| InChIKey | UKNVFJDIQRUEME-NFJWQWPMSA-N |
| XLogP | -0.69 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|