C17H19ClN4O2 — CID 23529088
7-(1-chloropentan-3-yl)-8,10-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 23529088) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 7-(1-chloropentan-3-yl)-8,10-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 7-(1-chloropentan-3-yl)-8,10-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 23529088 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 7-(1-chloropentan-3-yl)-8,10-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | CCC(CCCl)c1cc2nc3c(=O)[nH]c(=O)nc-3n(C)c2cc1C |
| InChI | InChI=1S/C17H19ClN4O2/c1-4-10(5-6-18)11-8-12-13(7-9(11)2)22(3)15-14(19-12)16(23)21-17(24)20-15/h7-8,10H,4-6H2,1-3H3,(H,21,23,24) |
| InChIKey | CIFVJYUPYTYAJP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|