C13H11N4O2W- — CID 59963690
8-methanidyl-7,10-dimethylbenzo[g]pteridine-2,4-dione;tungsten (PubChem CID 59963690) has the molecular formula C13H11N4O2W- and a molecular weight of 439.10 g/mol. Its IUPAC name is 8-methanidyl-7,10-dimethylbenzo[g]pteridine-2,4-dione;tungsten.
| Compound Name | 8-methanidyl-7,10-dimethylbenzo[g]pteridine-2,4-dione;tungsten |
|---|---|
| PubChem CID | 59963690 |
| Molecular Formula | C13H11N4O2W- |
| Molecular Weight | 439.10 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 8-methanidyl-7,10-dimethylbenzo[g]pteridine-2,4-dione;tungsten |
| SMILES | [CH2-]c1cc2c(cc1C)nc1c(=O)[nH]c(=O)nc-1n2C.[W] |
| InChI | InChI=1S/C13H11N4O2.W/c1-6-4-8-9(5-7(6)2)17(3)11-10(14-8)12(18)16-13(19)15-11;/h4-5H,2H2,1,3H3,(H,16,18,19);/q-1; |
| InChIKey | JCJACGMQHDXRSC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.10 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|