C12H11N5O2 — CID 102221386
7,8,10-trimethylpyrido[3,2-g]pteridine-2,4-dione (PubChem CID 102221386) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 7,8,10-trimethylpyrido[3,2-g]pteridine-2,4-dione.
| Compound Name | 7,8,10-trimethylpyrido[3,2-g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 102221386 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 7,8,10-trimethylpyrido[3,2-g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C)c2nc1C |
| InChI | InChI=1S/C12H11N5O2/c1-5-4-7-9(13-6(5)2)17(3)10-8(14-7)11(18)16-12(19)15-10/h4H,1-3H3,(H,16,18,19) |
| InChIKey | AUZJUVXORMZVHV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|