C24H25ClN4O2 — CID 53491758
10-[3-(4-chlorophenyl)pentyl]-7-propan-2-ylbenzo[g]pteridine-2,4-dione (PubChem CID 53491758) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 10-[3-(4-chlorophenyl)pentyl]-7-propan-2-ylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[3-(4-chlorophenyl)pentyl]-7-propan-2-ylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 53491758 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 10-[3-(4-chlorophenyl)pentyl]-7-propan-2-ylbenzo[g]pteridine-2,4-dione |
| SMILES | CCC(CCn1c2nc(=O)[nH]c(=O)c-2nc2cc(C(C)C)ccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H25ClN4O2/c1-4-15(16-5-8-18(25)9-6-16)11-12-29-20-10-7-17(14(2)3)13-19(20)26-21-22(29)27-24(31)28-23(21)30/h5-10,13-15H,4,11-12H2,1-3H3,(H,28,30,31) |
| InChIKey | YQDYDFCBYCVAGH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|