C24H26N4O2 — CID 89398754
7-tert-butyl-10-[3-(4-methylphenyl)propyl]benzo[g]pteridine-2,4-dione (PubChem CID 89398754) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 7-tert-butyl-10-[3-(4-methylphenyl)propyl]benzo[g]pteridine-2,4-dione.
| Compound Name | 7-tert-butyl-10-[3-(4-methylphenyl)propyl]benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 89398754 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 7-tert-butyl-10-[3-(4-methylphenyl)propyl]benzo[g]pteridine-2,4-dione |
| SMILES | Cc1ccc(CCCn2c3nc(=O)[nH]c(=O)c-3nc3cc(C(C)(C)C)ccc32)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-15-7-9-16(10-8-15)6-5-13-28-19-12-11-17(24(2,3)4)14-18(19)25-20-21(28)26-23(30)27-22(20)29/h7-12,14H,5-6,13H2,1-4H3,(H,27,29,30) |
| InChIKey | GJJFDPYVHAKJHM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|