C18H20N4O4 — CID 87168225
7-(7-methyl-2,4-dioxobenzo[g]pteridin-10-yl)heptanoic acid (PubChem CID 87168225) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 7-(7-methyl-2,4-dioxobenzo[g]pteridin-10-yl)heptanoic acid.
| Compound Name | 7-(7-methyl-2,4-dioxobenzo[g]pteridin-10-yl)heptanoic acid |
|---|---|
| PubChem CID | 87168225 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 7-(7-methyl-2,4-dioxobenzo[g]pteridin-10-yl)heptanoic acid |
| SMILES | Cc1ccc2c(c1)nc1c(=O)[nH]c(=O)nc-1n2CCCCCCC(=O)O |
| InChI | InChI=1S/C18H20N4O4/c1-11-7-8-13-12(10-11)19-15-16(20-18(26)21-17(15)25)22(13)9-5-3-2-4-6-14(23)24/h7-8,10H,2-6,9H2,1H3,(H,23,24)(H,21,25,26) |
| InChIKey | WJJSJNMOGMCXDS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|