C30H27N5O4 — CID 172990375
7-[8-(9H-carbazol-4-yl)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]heptanoic acid (PubChem CID 172990375) has the molecular formula C30H27N5O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is 7-[8-(9H-carbazol-4-yl)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]heptanoic acid.
| Compound Name | 7-[8-(9H-carbazol-4-yl)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]heptanoic acid |
|---|---|
| PubChem CID | 172990375 |
| Molecular Formula | C30H27N5O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 7-[8-(9H-carbazol-4-yl)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]heptanoic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCCCCCC(=O)O)c2cc1-c1cccc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C30H27N5O4/c1-17-15-23-24(16-20(17)18-10-8-12-22-26(18)19-9-5-6-11-21(19)31-22)35(14-7-3-2-4-13-25(36)37)28-27(32-23)29(38)34-30(39)33-28/h5-6,8-12,15-16,31H,2-4,7,13-14H2,1H3,(H,36,37)(H,34,38,39) |
| InChIKey | LIDUFABUWYSDQM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|