C26H29N5O4 — CID 87168704
4-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl-[(4-methylphenyl)methyl]amino]butanoic acid (PubChem CID 87168704) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl-[(4-methylphenyl)methyl]amino]butanoic acid.
| Compound Name | 4-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl-[(4-methylphenyl)methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 87168704 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 4-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl-[(4-methylphenyl)methyl]amino]butanoic acid |
| SMILES | Cc1ccc(CN(CCCC(=O)O)CCn2c3nc(=O)[nH]c(=O)c-3nc3cc(C)c(C)cc32)cc1 |
| InChI | InChI=1S/C26H29N5O4/c1-16-6-8-19(9-7-16)15-30(10-4-5-22(32)33)11-12-31-21-14-18(3)17(2)13-20(21)27-23-24(31)28-26(35)29-25(23)34/h6-9,13-14H,4-5,10-12,15H2,1-3H3,(H,32,33)(H,29,34,35) |
| InChIKey | QYUMSIASZOLTPI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|