C18H18N4O5 — CID 90865312
6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-oxohexanoic acid (PubChem CID 90865312) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is 6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-oxohexanoic acid.
| Compound Name | 6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-oxohexanoic acid |
|---|---|
| PubChem CID | 90865312 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-oxohexanoic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(=O)CCCC(=O)O)c2cc1C |
| InChI | InChI=1S/C18H18N4O5/c1-9-6-12-13(7-10(9)2)22(8-11(23)4-3-5-14(24)25)16-15(19-12)17(26)21-18(27)20-16/h6-7H,3-5,8H2,1-2H3,(H,24,25)(H,21,26,27) |
| InChIKey | WTLQDBMRMCNVRY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|