C19H22N4O4 — CID 90878830
5-(7-methyl-2,4-dioxo-8-propan-2-ylbenzo[g]pteridin-10-yl)pentanoic acid (PubChem CID 90878830) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-(7-methyl-2,4-dioxo-8-propan-2-ylbenzo[g]pteridin-10-yl)pentanoic acid.
| Compound Name | 5-(7-methyl-2,4-dioxo-8-propan-2-ylbenzo[g]pteridin-10-yl)pentanoic acid |
|---|---|
| PubChem CID | 90878830 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 5-(7-methyl-2,4-dioxo-8-propan-2-ylbenzo[g]pteridin-10-yl)pentanoic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCCCC(=O)O)c2cc1C(C)C |
| InChI | InChI=1S/C19H22N4O4/c1-10(2)12-9-14-13(8-11(12)3)20-16-17(21-19(27)22-18(16)26)23(14)7-5-4-6-15(24)25/h8-10H,4-7H2,1-3H3,(H,24,25)(H,22,26,27) |
| InChIKey | ALYDQZQJYMQXSO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|