C21H23F3N4O4 — CID 71538608
ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate (PubChem CID 71538608) has the molecular formula C21H23F3N4O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate.
| Compound Name | ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate |
|---|---|
| PubChem CID | 71538608 |
| Molecular Formula | C21H23F3N4O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C(F)(F)F)cc21 |
| InChI | InChI=1S/C21H23F3N4O4/c1-3-32-16(29)8-6-4-5-7-9-28-15-11-13(21(22,23)24)12(2)10-14(15)25-17-18(28)26-20(31)27-19(17)30/h10-11H,3-9H2,1-2H3,(H,27,30,31) |
| InChIKey | OQPIETDTSLXHTE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|