About ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate
ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate (PubChem CID 71538608) has the molecular formula C21H23F3N4O4
and a molecular weight of 452.43 g/mol. Its IUPAC name is ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate.
Molecular Properties
| Compound Name | ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate |
| PubChem CID | 71538608 |
| Molecular Formula | C21H23F3N4O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C(F)(F)F)cc21 |
| InChI | InChI=1S/C21H23F3N4O4/c1-3-32-16(29)8-6-4-5-7-9-28-15-11-13(21(22,23)24)12(2)10-14(15)25-17-18(28)26-20(31)27-19(17)30/h10-11H,3-9H2,1-2H3,(H,27,30,31) |
| InChIKey | OQPIETDTSLXHTE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate?
The IUPAC name of ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate (CID 71538608) is ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate.
What is the SMILES notation for ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate?
The canonical SMILES for ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate is CCOC(=O)CCCCCCn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C(F)(F)F)cc21.
What is the InChIKey of ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate?
The InChIKey is OQPIETDTSLXHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F3N4O4/c1-3-32-16(29)8-6-4-5-7-9-28-15-11-13(21(22,23)24)12(2)10-14(15)25-17-18(28)26-20(31)27-19(17)30/h10-11H,3-9H2,1-2H3,(H,27,30,31).
What are the key properties of ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate?
ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate has a molecular weight of 452.43 g/mol, XLogP of 3.43, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[7-methyl-2,4-dioxo-8-(trifluoromethyl)benzo[g]pteridin-10-yl]heptanoate is sourced from PubChem (CID 71538608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).