C19H24N4O3 — CID 143941805
7-(2,4-dioxobenzo[g]pteridin-10-yl)heptanal;ethane (PubChem CID 143941805) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 7-(2,4-dioxobenzo[g]pteridin-10-yl)heptanal;ethane.
| Compound Name | 7-(2,4-dioxobenzo[g]pteridin-10-yl)heptanal;ethane |
|---|---|
| PubChem CID | 143941805 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 7-(2,4-dioxobenzo[g]pteridin-10-yl)heptanal;ethane |
| SMILES | CC.O=CCCCCCCn1c2nc(=O)[nH]c(=O)c-2nc2ccccc21 |
| InChI | InChI=1S/C17H18N4O3.C2H6/c22-11-7-3-1-2-6-10-21-13-9-5-4-8-12(13)18-14-15(21)19-17(24)20-16(14)23;1-2/h4-5,8-9,11H,1-3,6-7,10H2,(H,20,23,24);1-2H3 |
| InChIKey | FBWWKWXROHAGOD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|