C22H21FN4O2 — CID 53492166
10-[3-(4-fluorophenyl)propyl]-7-propylbenzo[g]pteridine-2,4-dione (PubChem CID 53492166) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 10-[3-(4-fluorophenyl)propyl]-7-propylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[3-(4-fluorophenyl)propyl]-7-propylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 53492166 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 10-[3-(4-fluorophenyl)propyl]-7-propylbenzo[g]pteridine-2,4-dione |
| SMILES | CCCc1ccc2c(c1)nc1c(=O)[nH]c(=O)nc-1n2CCCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN4O2/c1-2-4-15-8-11-18-17(13-15)24-19-20(25-22(29)26-21(19)28)27(18)12-3-5-14-6-9-16(23)10-7-14/h6-11,13H,2-5,12H2,1H3,(H,26,28,29) |
| InChIKey | CLRNVVCBWPWMGR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|