C27H32FN5O2 — CID 91504512
8-[2-(4-fluorophenyl)ethylamino]-7-methyl-10-octylbenzo[g]pteridine-2,4-dione (PubChem CID 91504512) has the molecular formula C27H32FN5O2 and a molecular weight of 477.58 g/mol. Its IUPAC name is 8-[2-(4-fluorophenyl)ethylamino]-7-methyl-10-octylbenzo[g]pteridine-2,4-dione.
| Compound Name | 8-[2-(4-fluorophenyl)ethylamino]-7-methyl-10-octylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 91504512 |
| Molecular Formula | C27H32FN5O2 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 8-[2-(4-fluorophenyl)ethylamino]-7-methyl-10-octylbenzo[g]pteridine-2,4-dione |
| SMILES | CCCCCCCCn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(NCCc3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C27H32FN5O2/c1-3-4-5-6-7-8-15-33-23-17-21(29-14-13-19-9-11-20(28)12-10-19)18(2)16-22(23)30-24-25(33)31-27(35)32-26(24)34/h9-12,16-17,29H,3-8,13-15H2,1-2H3,(H,32,34,35) |
| InChIKey | ZMWFATQLBKEVMU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|